C21H19FN2O4S — CID 126216302
methyl 2-[(4Z)-4-[[2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126216302) has the molecular formula C21H19FN2O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl 2-[(4Z)-4-[[2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(4Z)-4-[[2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126216302 |
| Molecular Formula | C21H19FN2O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 2-[(4Z)-4-[[2-[(4-fluorophenyl)methoxy]phenyl]methylidene]-3-methyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)/C(=C/c2ccccc2OCc2ccc(F)cc2)N(C)C1=S |
| InChI | InChI=1S/C21H19FN2O4S/c1-23-17(20(26)24(21(23)29)12-19(25)27-2)11-15-5-3-4-6-18(15)28-13-14-7-9-16(22)10-8-14/h3-11H,12-13H2,1-2H3/b17-11- |
| InChIKey | DNXOMVUTLBCPFO-BOPFTXTBSA-N |
| XLogP | 2.98 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|