C20H16Cl2N2O5 — CID 4017494
methyl 2-[4-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 4017494) has the molecular formula C20H16Cl2N2O5 and a molecular weight of 435.26 g/mol. Its IUPAC name is methyl 2-[4-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 4017494 |
| Molecular Formula | C20H16Cl2N2O5 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | methyl 2-[4-[[2-[(3,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)NC(=Cc2ccccc2OCc2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C20H16Cl2N2O5/c1-28-18(25)10-24-19(26)16(23-20(24)27)9-13-4-2-3-5-17(13)29-11-12-6-7-14(21)15(22)8-12/h2-9H,10-11H2,1H3,(H,23,27) |
| InChIKey | PRWVCWDHESXABF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|