C21H22N4O3S — CID 126219491
[2-(4-methylanilino)-2-oxoethyl] 4-[(E)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]benzoate (PubChem CID 126219491) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]benzoate |
|---|---|
| PubChem CID | 126219491 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 4-[(E)-(prop-2-enylcarbamothioylhydrazinylidene)methyl]benzoate |
| SMILES | C=CCNC(=S)N/N=C/c1ccc(C(=O)OCC(=O)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-12-22-21(29)25-23-13-16-6-8-17(9-7-16)20(27)28-14-19(26)24-18-10-4-15(2)5-11-18/h3-11,13H,1,12,14H2,2H3,(H,24,26)(H2,22,25,29)/b23-13+ |
| InChIKey | SGKLMTIHSXCOBA-YDZHTSKRSA-N |
| XLogP | 2.77 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|