C25H19N3O8 — CID 126222696
(5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126222696) has the molecular formula C25H19N3O8 and a molecular weight of 489.44 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126222696 |
| Molecular Formula | C25H19N3O8 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | (5E)-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1-(4-phenylmethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OCc4ccccc4)cc3)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C25H19N3O8/c1-35-21-13-16(12-20(22(21)29)28(33)34)11-19-23(30)26-25(32)27(24(19)31)17-7-9-18(10-8-17)36-14-15-5-3-2-4-6-15/h2-13,29H,14H2,1H3,(H,26,30,32)/b19-11+ |
| InChIKey | LZARLWNYWAMIMH-YBFXNURJSA-N |
| XLogP | 3.55 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|