C17H13N3O2S — CID 126235078
(E)-N-carbamoyl-2-cyano-3-(2-phenylsulfanylphenyl)prop-2-enamide (PubChem CID 126235078) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is (E)-N-carbamoyl-2-cyano-3-(2-phenylsulfanylphenyl)prop-2-enamide.
| Compound Name | (E)-N-carbamoyl-2-cyano-3-(2-phenylsulfanylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126235078 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (E)-N-carbamoyl-2-cyano-3-(2-phenylsulfanylphenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1Sc1ccccc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C17H13N3O2S/c18-11-13(16(21)20-17(19)22)10-12-6-4-5-9-15(12)23-14-7-2-1-3-8-14/h1-10H,(H3,19,20,21,22)/b13-10+ |
| InChIKey | GPYFSTZYQSNLEZ-JLHYYAGUSA-N |
| XLogP | 2.94 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|