C13H10O4 — CID 12624473
2-(1,3-dioxolan-2-yl)naphthalene-1,4-dione (PubChem CID 12624473) has the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)naphthalene-1,4-dione.
| Compound Name | 2-(1,3-dioxolan-2-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 12624473 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)naphthalene-1,4-dione |
| SMILES | O=C1C=C(C2OCCO2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C13H10O4/c14-11-7-10(13-16-5-6-17-13)12(15)9-4-2-1-3-8(9)11/h1-4,7,13H,5-6H2 |
| InChIKey | CIOCFGIIKTZYLW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|