C26H24FN3OS — CID 126246619
(5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126246619) has the molecular formula C26H24FN3OS and a molecular weight of 445.56 g/mol. Its IUPAC name is (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126246619 |
| Molecular Formula | C26H24FN3OS |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (5E)-3-ethyl-2-(4-fluorophenyl)imino-5-[(4-pyrrolidin-1-ylnaphthalen-1-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc(N3CCCC3)c3ccccc23)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C26H24FN3OS/c1-2-30-25(31)24(32-26(30)28-20-12-10-19(27)11-13-20)17-18-9-14-23(29-15-5-6-16-29)22-8-4-3-7-21(18)22/h3-4,7-14,17H,2,5-6,15-16H2,1H3/b24-17+,28-26- |
| InChIKey | TYCCIXJIGGJCMP-PIDRKRQWSA-N |
| XLogP | 6.20 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|