C8H11ClO2 — CID 12625643
4-chloro-1-methylcyclohex-2-ene-1-carboxylic acid (PubChem CID 12625643) has the molecular formula C8H11ClO2 and a molecular weight of 174.63 g/mol. Its IUPAC name is 4-chloro-1-methylcyclohex-2-ene-1-carboxylic acid.
| Compound Name | 4-chloro-1-methylcyclohex-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 12625643 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 4-chloro-1-methylcyclohex-2-ene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)C=CC(Cl)CC1 |
| InChI | InChI=1S/C8H11ClO2/c1-8(7(10)11)4-2-6(9)3-5-8/h2,4,6H,3,5H2,1H3,(H,10,11) |
| InChIKey | CUXBCXGWOCBLPO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|