C14H19NO4 — CID 175173207
3-ethyl-2,5-dimethyl-2,4-dihydro-1H-indole-3,5-dicarboxylic acid (PubChem CID 175173207) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-ethyl-2,5-dimethyl-2,4-dihydro-1H-indole-3,5-dicarboxylic acid.
| Compound Name | 3-ethyl-2,5-dimethyl-2,4-dihydro-1H-indole-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 175173207 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-ethyl-2,5-dimethyl-2,4-dihydro-1H-indole-3,5-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)C2=C(C=CC(C)(C(=O)O)C2)NC1C |
| InChI | InChI=1S/C14H19NO4/c1-4-14(12(18)19)8(2)15-10-5-6-13(3,11(16)17)7-9(10)14/h5-6,8,15H,4,7H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | SJGHMKCYDFVOLS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |