C11H10O4 — CID 150716830
4-ethynyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 150716830) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 4-ethynyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 4-ethynyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150716830 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4-ethynyl-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | C#CC1=C(C(=O)O)CC(C)(C(=O)O)C=C1 |
| InChI | InChI=1S/C11H10O4/c1-3-7-4-5-11(2,10(14)15)6-8(7)9(12)13/h1,4-5H,6H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | JPAYOQOKTGTHKR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|