C17H17FN2O4 — CID 170053442
5-[N-(4-fluorobenzoyl)carbamimidoyl]-2-methoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 170053442) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is 5-[N-(4-fluorobenzoyl)carbamimidoyl]-2-methoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5-[N-(4-fluorobenzoyl)carbamimidoyl]-2-methoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 170053442 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 5-[N-(4-fluorobenzoyl)carbamimidoyl]-2-methoxy-5-methylcyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | [H]/N=C(\NC(=O)c1ccc(F)cc1)C1(C)C=CC(OC)=C(C(=O)O)C1 |
| InChI | InChI=1S/C17H17FN2O4/c1-17(8-7-13(24-2)12(9-17)15(22)23)16(19)20-14(21)10-3-5-11(18)6-4-10/h3-8H,9H2,1-2H3,(H,22,23)(H2,19,20,21) |
| InChIKey | GBWQCFYHHWUDNP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|