C23H23F3N4O5 — CID 126273942
N-[[(2R)-oxolan-2-yl]methyl]-N'-[(Z)-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide (PubChem CID 126273942) has the molecular formula C23H23F3N4O5 and a molecular weight of 492.45 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-N'-[(Z)-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-N'-[(Z)-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126273942 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-N'-[(Z)-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(COc1ccccc1/C=N\NC(=O)C(=O)NC[C@H]1CCCO1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H23F3N4O5/c24-23(25,26)17-8-2-3-9-18(17)29-20(31)14-35-19-10-4-1-6-15(19)12-28-30-22(33)21(32)27-13-16-7-5-11-34-16/h1-4,6,8-10,12,16H,5,7,11,13-14H2,(H,27,32)(H,29,31)(H,30,33)/b28-12-/t16-/m1/s1 |
| InChIKey | OZBYIFSRLYJACB-NHRHHVFYSA-N |
| XLogP | 2.47 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|