C17H16Br2N2O3 — CID 126275636
2-[2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126275636) has the molecular formula C17H16Br2N2O3 and a molecular weight of 456.13 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126275636 |
| Molecular Formula | C17H16Br2N2O3 |
| Molecular Weight | 456.13 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-hydroxyiminomethyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2c(Br)cc(/C=N/O)cc2Br)c(C)c1 |
| InChI | InChI=1S/C17H16Br2N2O3/c1-10-3-4-15(11(2)5-10)21-16(22)9-24-17-13(18)6-12(8-20-23)7-14(17)19/h3-8,23H,9H2,1-2H3,(H,21,22)/b20-8+ |
| InChIKey | JROYKCXOAMGMKM-DNTJNYDQSA-N |
| XLogP | 4.65 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|