C29H22ClN5O7 — CID 126287899
2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126287899) has the molecular formula C29H22ClN5O7 and a molecular weight of 587.98 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126287899 |
| Molecular Formula | C29H22ClN5O7 |
| Molecular Weight | 587.98 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[2-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1C=Nn1c(-c2cc3cc(Cl)ccc3o2)nc2ccccc2c1=O)N1CCOCC1 |
| InChI | InChI=1S/C29H22ClN5O7/c30-20-5-7-25-18(13-20)15-26(42-25)28-32-23-4-2-1-3-22(23)29(37)34(28)31-16-19-14-21(35(38)39)6-8-24(19)41-17-27(36)33-9-11-40-12-10-33/h1-8,13-16H,9-12,17H2 |
| InChIKey | OANQKIIHPCZFDK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 142.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.98 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|