C29H21Cl2N5O7 — CID 126289034
2-(5-chloro-1-benzofuran-2-yl)-3-[[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126289034) has the molecular formula C29H21Cl2N5O7 and a molecular weight of 622.42 g/mol. Its IUPAC name is 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126289034 |
| Molecular Formula | C29H21Cl2N5O7 |
| Molecular Weight | 622.42 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | 2-(5-chloro-1-benzofuran-2-yl)-3-[[3-chloro-4-(2-morpholin-4-yl-2-oxoethoxy)-5-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=C(COc1c(Cl)cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-])N1CCOCC1 |
| InChI | InChI=1S/C29H21Cl2N5O7/c30-19-5-6-24-18(13-19)14-25(43-24)28-33-22-4-2-1-3-20(22)29(38)35(28)32-15-17-11-21(31)27(23(12-17)36(39)40)42-16-26(37)34-7-9-41-10-8-34/h1-6,11-15H,7-10,16H2 |
| InChIKey | PIGICNYZVNOQKJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 142.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|