C32H27BrN6O7 — CID 126292892
3-[[3-bromo-5-nitro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126292892) has the molecular formula C32H27BrN6O7 and a molecular weight of 687.51 g/mol. Its IUPAC name is 3-[[3-bromo-5-nitro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-nitro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126292892 |
| Molecular Formula | C32H27BrN6O7 |
| Molecular Weight | 687.51 g/mol |
| Exact Mass | 686.11 |
| IUPAC Name | 3-[[3-bromo-5-nitro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)c(Oc3ccc([N+](=O)[O-])cn3)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C32H27BrN6O7/c1-5-45-28-12-19(4)24(15-23(28)18(2)3)31-36-26-9-7-6-8-22(26)32(40)37(31)35-16-20-13-25(33)30(27(14-20)39(43)44)46-29-11-10-21(17-34-29)38(41)42/h6-18H,5H2,1-4H3 |
| InChIKey | ZNEUDMDFMVJZPC-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 164.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.51 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|