C14H13F3N4O6S — CID 1262951
1-(4,6-dimethoxypyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea (PubChem CID 1262951) has the molecular formula C14H13F3N4O6S and a molecular weight of 422.34 g/mol. Its IUPAC name is 1-(4,6-dimethoxypyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea.
| Compound Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 1262951 |
| Molecular Formula | C14H13F3N4O6S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 1-(4,6-dimethoxypyrimidin-2-yl)-3-[4-(trifluoromethoxy)phenyl]sulfonylurea |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H13F3N4O6S/c1-25-10-7-11(26-2)19-12(18-10)20-13(22)21-28(23,24)9-5-3-8(4-6-9)27-14(15,16)17/h3-7H,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | HMYJPGYMIBEFAA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |