C24H26BrFN4O — CID 126318023
6-bromo-2-butyl-3-[(2-fluoro-4-piperidin-1-ylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126318023) has the molecular formula C24H26BrFN4O and a molecular weight of 485.40 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[(2-fluoro-4-piperidin-1-ylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[(2-fluoro-4-piperidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126318023 |
| Molecular Formula | C24H26BrFN4O |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 6-bromo-2-butyl-3-[(2-fluoro-4-piperidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N2CCCCC2)cc1F |
| InChI | InChI=1S/C24H26BrFN4O/c1-2-3-7-23-28-22-11-9-18(25)14-20(22)24(31)30(23)27-16-17-8-10-19(15-21(17)26)29-12-5-4-6-13-29/h8-11,14-16H,2-7,12-13H2,1H3 |
| InChIKey | CESVJYXFVXFMKZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|