C23H24BrFN4O — CID 126330536
6-bromo-2-[(2S)-butan-2-yl]-3-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126330536) has the molecular formula C23H24BrFN4O and a molecular weight of 471.37 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126330536 |
| Molecular Formula | C23H24BrFN4O |
| Molecular Weight | 471.37 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[(2-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N2CCCC2)cc1F |
| InChI | InChI=1S/C23H24BrFN4O/c1-3-15(2)22-27-21-9-7-17(24)12-19(21)23(30)29(22)26-14-16-6-8-18(13-20(16)25)28-10-4-5-11-28/h6-9,12-15H,3-5,10-11H2,1-2H3/t15-/m0/s1 |
| InChIKey | SIKVGVDARUOPCI-HNNXBMFYSA-N |
| XLogP | 5.29 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|