C25H29BrN4O — CID 126319032
6-bromo-2-[(2R)-butan-2-yl]-3-[(2,3-dimethyl-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126319032) has the molecular formula C25H29BrN4O and a molecular weight of 481.44 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,3-dimethyl-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,3-dimethyl-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126319032 |
| Molecular Formula | C25H29BrN4O |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2,3-dimethyl-4-pyrrolidin-1-ylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N2CCCC2)c(C)c1C |
| InChI | InChI=1S/C25H29BrN4O/c1-5-16(2)24-28-22-10-9-20(26)14-21(22)25(31)30(24)27-15-19-8-11-23(18(4)17(19)3)29-12-6-7-13-29/h8-11,14-16H,5-7,12-13H2,1-4H3/t16-/m1/s1 |
| InChIKey | ADXMPASKPLMGQA-MRXNPFEDSA-N |
| XLogP | 5.77 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|