C22H15FO2S — CID 126318139
(2Z)-2-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one (PubChem CID 126318139) has the molecular formula C22H15FO2S and a molecular weight of 362.43 g/mol. Its IUPAC name is (2Z)-2-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 126318139 |
| Molecular Formula | C22H15FO2S |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (2Z)-2-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C/c2cccc(OCc3ccccc3F)c2)Sc2ccccc21 |
| InChI | InChI=1S/C22H15FO2S/c23-19-10-3-1-7-16(19)14-25-17-8-5-6-15(12-17)13-21-22(24)18-9-2-4-11-20(18)26-21/h1-13H,14H2/b21-13- |
| InChIKey | IMSNTQKUUYOYCB-BKUYFWCQSA-N |
| XLogP | 5.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_F(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|