C21H21NOS — CID 126343289
(6S,6aR)-9,9-dimethyl-6-phenyl-6,6a,8,10-tetrahydrobenzo[c][1,5]benzothiazepin-7-one (PubChem CID 126343289) has the molecular formula C21H21NOS and a molecular weight of 335.47 g/mol. Its IUPAC name is (6S,6aR)-9,9-dimethyl-6-phenyl-6,6a,8,10-tetrahydrobenzo[c][1,5]benzothiazepin-7-one.
| Compound Name | (6S,6aR)-9,9-dimethyl-6-phenyl-6,6a,8,10-tetrahydrobenzo[c][1,5]benzothiazepin-7-one |
|---|---|
| PubChem CID | 126343289 |
| Molecular Formula | C21H21NOS |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (6S,6aR)-9,9-dimethyl-6-phenyl-6,6a,8,10-tetrahydrobenzo[c][1,5]benzothiazepin-7-one |
| SMILES | CC1(C)CC(=O)[C@H]2C(=Nc3ccccc3S[C@@H]2c2ccccc2)C1 |
| InChI | InChI=1S/C21H21NOS/c1-21(2)12-16-19(17(23)13-21)20(14-8-4-3-5-9-14)24-18-11-7-6-10-15(18)22-16/h3-11,19-20H,12-13H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | YEEUOUBZGDGPFR-WOJBJXKFSA-N |
| XLogP | 5.61 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |