C7H15NS — CID 12634517
3-ethyl-2-methyl-1,3-thiazinane (PubChem CID 12634517) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is 3-ethyl-2-methyl-1,3-thiazinane.
| Compound Name | 3-ethyl-2-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 12634517 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-ethyl-2-methyl-1,3-thiazinane |
| SMILES | CCN1CCCSC1C |
| InChI | InChI=1S/C7H15NS/c1-3-8-5-4-6-9-7(8)2/h7H,3-6H2,1-2H3 |
| InChIKey | ORFNUMXLBUATHF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |