C20H18BrN3O3S2 — CID 126348175
N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetamide (PubChem CID 126348175) has the molecular formula C20H18BrN3O3S2 and a molecular weight of 492.42 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126348175 |
| Molecular Formula | C20H18BrN3O3S2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)COc2ccc(/C=N/N3C(=O)CSC3=S)cc2)cc1C |
| InChI | InChI=1S/C20H18BrN3O3S2/c1-12-7-16(21)17(8-13(12)2)23-18(25)10-27-15-5-3-14(4-6-15)9-22-24-19(26)11-29-20(24)28/h3-9H,10-11H2,1-2H3,(H,23,25)/b22-9+ |
| InChIKey | BRCHDHOUZATQLP-LSFURLLWSA-N |
| XLogP | 4.28 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|