About (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene
(Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene (PubChem CID 12635053) has the molecular formula C8H9F7
and a molecular weight of 238.15 g/mol. Its IUPAC name is (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene.
Analyze (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene?
The IUPAC name of (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene (CID 12635053) is (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene.
What is the SMILES notation for (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene?
The canonical SMILES for (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene is CCC/C=C(\F)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene?
The InChIKey is CBEUEMNVWKOOLS-PLNGDYQASA-N. The full InChI is InChI=1S/C8H9F7/c1-2-3-4-5(9)6(7(10,11)12)8(13,14)15/h4,6H,2-3H2,1H3/b5-4-.
What are the key properties of (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene?
(Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene has a molecular weight of 238.15 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,1,3-tetrafluoro-2-(trifluoromethyl)hept-3-ene is sourced from PubChem (CID 12635053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).