C28H27ClN2O3S2 — CID 126359876
(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-3-(2,5-dimethylpyrrol-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126359876) has the molecular formula C28H27ClN2O3S2 and a molecular weight of 539.12 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-3-(2,5-dimethylpyrrol-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-3-(2,5-dimethylpyrrol-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126359876 |
| Molecular Formula | C28H27ClN2O3S2 |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylidene]-3-(2,5-dimethylpyrrol-1-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2\SC(=S)N(n3c(C)ccc3C)C2=O)cc(OCC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27ClN2O3S2/c1-5-7-22-14-21(15-24(33-6-2)26(22)34-17-20-10-12-23(29)13-11-20)16-25-27(32)31(28(35)36-25)30-18(3)8-9-19(30)4/h5,8-16H,1,6-7,17H2,2-4H3/b25-16- |
| InChIKey | DSCOCIYFCAJWNL-XYGWBWBKSA-N |
| XLogP | 7.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|