C28H27BrN4O3S — CID 126367735
N-[(E)-(2-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide (PubChem CID 126367735) has the molecular formula C28H27BrN4O3S and a molecular weight of 579.52 g/mol. Its IUPAC name is N-[(E)-(2-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[(E)-(2-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 126367735 |
| Molecular Formula | C28H27BrN4O3S |
| Molecular Weight | 579.52 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | N-[(E)-(2-bromo-5-methoxy-4-propoxyphenyl)methylideneamino]-4-[2-(4-methylanilino)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCCOc1cc(Br)c(/C=N/NC(=O)c2ccc(-c3csc(Nc4ccc(C)cc4)n3)cc2)cc1OC |
| InChI | InChI=1S/C28H27BrN4O3S/c1-4-13-36-26-15-23(29)21(14-25(26)35-3)16-30-33-27(34)20-9-7-19(8-10-20)24-17-37-28(32-24)31-22-11-5-18(2)6-12-22/h5-12,14-17H,4,13H2,1-3H3,(H,31,32)(H,33,34)/b30-16+ |
| InChIKey | SYRMPBLKTLYEAI-OKCVXOCRSA-N |
| XLogP | 7.19 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.52 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|