C19H20O4 — CID 12637063
2,3-dihydroxypropyl (E)-2-methyl-3-(4-phenylphenyl)prop-2-enoate (PubChem CID 12637063) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2,3-dihydroxypropyl (E)-2-methyl-3-(4-phenylphenyl)prop-2-enoate.
| Compound Name | 2,3-dihydroxypropyl (E)-2-methyl-3-(4-phenylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 12637063 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2,3-dihydroxypropyl (E)-2-methyl-3-(4-phenylphenyl)prop-2-enoate |
| SMILES | C/C(=C\c1ccc(-c2ccccc2)cc1)C(=O)OCC(O)CO |
| InChI | InChI=1S/C19H20O4/c1-14(19(22)23-13-18(21)12-20)11-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h2-11,18,20-21H,12-13H2,1H3/b14-11+ |
| InChIKey | TUDARVHBBDCAHK-SDNWHVSQSA-N |
| XLogP | 2.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|