C18H10Cl2N4O6S2 — CID 126373736
1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea (PubChem CID 126373736) has the molecular formula C18H10Cl2N4O6S2 and a molecular weight of 513.34 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
|---|---|
| PubChem CID | 126373736 |
| Molecular Formula | C18H10Cl2N4O6S2 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 511.94 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NN1C(=O)/C(=C/c2cc3c(cc2[N+](=O)[O-])OCO3)SC1=S |
| InChI | InChI=1S/C18H10Cl2N4O6S2/c19-10-2-1-9(5-11(10)20)21-17(26)22-23-16(25)15(32-18(23)31)4-8-3-13-14(30-7-29-13)6-12(8)24(27)28/h1-6H,7H2,(H2,21,22,26)/b15-4- |
| InChIKey | BUGDOKNIKCBEDI-TVPGTPATSA-N |
| XLogP | 4.57 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|