C17H14N2O3 — CID 126373878
(E)-3-(2-oxochromen-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 126373878) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is (E)-3-(2-oxochromen-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(2-oxochromen-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126373878 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (E)-3-(2-oxochromen-3-yl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc2ccccc2oc1=O)C(=O)N1CCCC1 |
| InChI | InChI=1S/C17H14N2O3/c18-11-14(16(20)19-7-3-4-8-19)10-13-9-12-5-1-2-6-15(12)22-17(13)21/h1-2,5-6,9-10H,3-4,7-8H2/b14-10+ |
| InChIKey | IPKIXYHSWUPXPL-GXDHUFHOSA-N |
| XLogP | 2.32 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|