3-(trifluoromethyl)benzenediazonium chloride

C7H4ClF3N2 — CID 12637886

IUPAC3-(trifluoromethyl)benzenediazonium chloride
SMILESN#[N+]c1cccc(C(F)(F)F)c1.[Cl-]
InChIInChI=1S/C7H4F3N2.ClH/c8-7(9,10)5-2-1-3-6(4-5)12-11;/h1-4H;1H/q+1;/p-1
InChIKeySWHKCIZXHHUPHN-UHFFFAOYSA-M
MW208.57 g/mol
LogP0.19
Rot. Bonds

About 3-(trifluoromethyl)benzenediazonium chloride

3-(trifluoromethyl)benzenediazonium chloride (PubChem CID 12637886) has the molecular formula C7H4ClF3N2 and a molecular weight of 208.57 g/mol. Its IUPAC name is 3-(trifluoromethyl)benzenediazonium chloride.

Molecular Properties

Compound Name3-(trifluoromethyl)benzenediazonium chloride
PubChem CID12637886
Molecular FormulaC7H4ClF3N2
Molecular Weight208.57 g/mol
Exact Mass208.00
IUPAC Name3-(trifluoromethyl)benzenediazonium chloride
SMILESN#[N+]c1cccc(C(F)(F)F)c1.[Cl-]
InChIInChI=1S/C7H4F3N2.ClH/c8-7(9,10)5-2-1-3-6(4-5)12-11;/h1-4H;1H/q+1;/p-1
InChIKeySWHKCIZXHHUPHN-UHFFFAOYSA-M
XLogP0.19
TPSA28.15 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.57
LogP ≤ 50.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Azo_group', 'substructure': 'N/A'}

Analyze 3-(trifluoromethyl)benzenediazonium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(trifluoromethyl)benzenediazonium chloride?
The IUPAC name of 3-(trifluoromethyl)benzenediazonium chloride (CID 12637886) is 3-(trifluoromethyl)benzenediazonium chloride.
What is the SMILES notation for 3-(trifluoromethyl)benzenediazonium chloride?
The canonical SMILES for 3-(trifluoromethyl)benzenediazonium chloride is N#[N+]c1cccc(C(F)(F)F)c1.[Cl-].
What is the InChIKey of 3-(trifluoromethyl)benzenediazonium chloride?
The InChIKey is SWHKCIZXHHUPHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H4F3N2.ClH/c8-7(9,10)5-2-1-3-6(4-5)12-11;/h1-4H;1H/q+1;/p-1.
What are the key properties of 3-(trifluoromethyl)benzenediazonium chloride?
3-(trifluoromethyl)benzenediazonium chloride has a molecular weight of 208.57 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)benzenediazonium chloride is sourced from PubChem (CID 12637886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).