C28H27N3O4S — CID 126393076
ethyl 2-[3-[[3-(benzylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]imino]-2-oxoindol-1-yl]acetate (PubChem CID 126393076) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is ethyl 2-[3-[[3-(benzylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]imino]-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[[3-(benzylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]imino]-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 126393076 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | ethyl 2-[3-[[3-(benzylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]imino]-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=Nc2sc3c(c2C(=O)NCc2ccccc2)CCCC3)c2ccccc21 |
| InChI | InChI=1S/C28H27N3O4S/c1-2-35-23(32)17-31-21-14-8-6-12-19(21)25(28(31)34)30-27-24(20-13-7-9-15-22(20)36-27)26(33)29-16-18-10-4-3-5-11-18/h3-6,8,10-12,14H,2,7,9,13,15-17H2,1H3,(H,29,33) |
| InChIKey | MCLSTYFADZRATR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|