C26H21N3O — CID 126395143
2,2-diphenyl-N-[(Z)-(1-prop-2-ynylindol-3-yl)methylideneamino]acetamide (PubChem CID 126395143) has the molecular formula C26H21N3O and a molecular weight of 391.47 g/mol. Its IUPAC name is 2,2-diphenyl-N-[(Z)-(1-prop-2-ynylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2,2-diphenyl-N-[(Z)-(1-prop-2-ynylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126395143 |
| Molecular Formula | C26H21N3O |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2,2-diphenyl-N-[(Z)-(1-prop-2-ynylindol-3-yl)methylideneamino]acetamide |
| SMILES | C#CCn1cc(/C=N\NC(=O)C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H21N3O/c1-2-17-29-19-22(23-15-9-10-16-24(23)29)18-27-28-26(30)25(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h1,3-16,18-19,25H,17H2,(H,28,30)/b27-18- |
| InChIKey | FORUUPKMOSKVMW-IMRQLAEWSA-N |
| XLogP | 4.56 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|