C21H19NO6 — CID 12640612
diethyl 2-[4-(1,3-dioxoinden-2-ylidene)-1-pyridinyl]propanedioate (PubChem CID 12640612) has the molecular formula C21H19NO6 and a molecular weight of 381.38 g/mol. Its IUPAC name is diethyl 2-[4-(1,3-dioxoinden-2-ylidene)-1-pyridinyl]propanedioate.
| Compound Name | diethyl 2-[4-(1,3-dioxoinden-2-ylidene)-1-pyridinyl]propanedioate |
|---|---|
| PubChem CID | 12640612 |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | diethyl 2-[4-(1,3-dioxoinden-2-ylidene)-1-pyridinyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N1C=CC(=C2C(=O)c3ccccc3C2=O)C=C1 |
| InChI | InChI=1S/C21H19NO6/c1-3-27-20(25)17(21(26)28-4-2)22-11-9-13(10-12-22)16-18(23)14-7-5-6-8-15(14)19(16)24/h5-12,17H,3-4H2,1-2H3 |
| InChIKey | SKVXGYBLJAEIEV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|