C33H32N4O6S — CID 126406451
methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[3-[(4-methylphenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 126406451) has the molecular formula C33H32N4O6S and a molecular weight of 612.71 g/mol. Its IUPAC name is methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[3-[(4-methylphenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[3-[(4-methylphenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 126406451 |
| Molecular Formula | C33H32N4O6S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | methyl 5-[[(4Z)-4-[[2,5-dimethyl-1-[3-[(4-methylphenyl)carbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]pyrrol-3-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N/C(=C\c3cc(C)n(-c4sc5c(c4C(=O)Nc4ccc(C)cc4)CCCC5)c3C)C2=O)o1 |
| InChI | InChI=1S/C33H32N4O6S/c1-18-9-11-22(12-10-18)34-29(38)28-24-7-5-6-8-27(24)44-31(28)37-19(2)15-21(20(37)3)16-25-30(39)36(33(41)35-25)17-23-13-14-26(43-23)32(40)42-4/h9-16H,5-8,17H2,1-4H3,(H,34,38)(H,35,41)/b25-16- |
| InChIKey | UMVQITDCGKYSCK-XYGWBWBKSA-N |
| XLogP | 6.07 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_F(8)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|