C20H16BrN3O2 — CID 126411774
(1R,2R,6S,7R)-4-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126411774) has the molecular formula C20H16BrN3O2 and a molecular weight of 410.27 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126411774 |
| Molecular Formula | C20H16BrN3O2 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1N=Cc1cccn1-c1ccc(Br)cc1)[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H16BrN3O2/c21-14-5-7-15(8-6-14)23-9-1-2-16(23)11-22-24-19(25)17-12-3-4-13(10-12)18(17)20(24)26/h1-9,11-13,17-18H,10H2/t12-,13-,17-,18+/m0/s1 |
| InChIKey | MKKABYTWVDOZBR-DSIZOQBWSA-N |
| XLogP | 3.38 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|