C23H27N5O2 — CID 126417795
N-[6-oxo-6-[[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]hexyl]pyrazine-2-carboxamide (PubChem CID 126417795) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[6-oxo-6-[[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]hexyl]pyrazine-2-carboxamide.
| Compound Name | N-[6-oxo-6-[[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]hexyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 126417795 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[6-oxo-6-[[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]amino]hexyl]pyrazine-2-carboxamide |
| SMILES | O=C(CCCCCNC(=O)c1cnccn1)N[C@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C23H27N5O2/c29-21(11-2-1-5-12-26-23(30)20-15-24-13-14-25-20)27-19-10-6-8-17-16-7-3-4-9-18(16)28-22(17)19/h3-4,7,9,13-15,19,28H,1-2,5-6,8,10-12H2,(H,26,30)(H,27,29)/t19-/m0/s1 |
| InChIKey | SHFNAVLZIADQGX-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|