C18H20N4O4 — CID 126418116
(4'aS,5R)-8'-amino-1-prop-2-enylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 126418116) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (4'aS,5R)-8'-amino-1-prop-2-enylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (4'aS,5R)-8'-amino-1-prop-2-enylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 126418116 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (4'aS,5R)-8'-amino-1-prop-2-enylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)[C@]2(Cc3cc(N)ccc3N3CCOC[C@@H]32)C1=O |
| InChI | InChI=1S/C18H20N4O4/c1-2-5-22-16(24)18(15(23)20-17(22)25)9-11-8-12(19)3-4-13(11)21-6-7-26-10-14(18)21/h2-4,8,14H,1,5-7,9-10,19H2,(H,20,23,25)/t14-,18-/m1/s1 |
| InChIKey | RZJVWHCEFUMBQI-RDTXWAMCSA-N |
| XLogP | 0.28 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|