C32H27N2O3P — CID 12643200
N-[(E)-(2-diphenoxyphosphoryl-1,2-diphenylethylidene)amino]aniline (PubChem CID 12643200) has the molecular formula C32H27N2O3P and a molecular weight of 518.55 g/mol. Its IUPAC name is N-[(E)-(2-diphenoxyphosphoryl-1,2-diphenylethylidene)amino]aniline.
| Compound Name | N-[(E)-(2-diphenoxyphosphoryl-1,2-diphenylethylidene)amino]aniline |
|---|---|
| PubChem CID | 12643200 |
| Molecular Formula | C32H27N2O3P |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[(E)-(2-diphenoxyphosphoryl-1,2-diphenylethylidene)amino]aniline |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)C(/C(=N/Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27N2O3P/c35-38(36-29-22-12-4-13-23-29,37-30-24-14-5-15-25-30)32(27-18-8-2-9-19-27)31(26-16-6-1-7-17-26)34-33-28-20-10-3-11-21-28/h1-25,32-33H/b34-31+ |
| InChIKey | WUNHTFXLEUNEBP-WUVHBKSUSA-N |
| XLogP | 8.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|