C22H26N4O2 — CID 126437718
(3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one (PubChem CID 126437718) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one.
| Compound Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
|---|---|
| PubChem CID | 126437718 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (3R)-3-(4-acetyl-3,5-dimethylpyrazol-1-yl)-1-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)butan-1-one |
| SMILES | CC(=O)c1c(C)nn([C@H](C)CC(=O)N2CCc3c([nH]c4ccccc34)C2)c1C |
| InChI | InChI=1S/C22H26N4O2/c1-13(26-15(3)22(16(4)27)14(2)24-26)11-21(28)25-10-9-18-17-7-5-6-8-19(17)23-20(18)12-25/h5-8,13,23H,9-12H2,1-4H3/t13-/m1/s1 |
| InChIKey | KBDYZTZWPQNLJW-CYBMUJFWSA-N |
| XLogP | 3.72 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|