C19H29N3O3 — CID 126440793
3-methyl-N-[4-methyl-3-[[(3S)-oxan-3-yl]methylcarbamoylamino]phenyl]butanamide (PubChem CID 126440793) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-methyl-N-[4-methyl-3-[[(3S)-oxan-3-yl]methylcarbamoylamino]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-methyl-3-[[(3S)-oxan-3-yl]methylcarbamoylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 126440793 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 3-methyl-N-[4-methyl-3-[[(3S)-oxan-3-yl]methylcarbamoylamino]phenyl]butanamide |
| SMILES | Cc1ccc(NC(=O)CC(C)C)cc1NC(=O)NC[C@@H]1CCCOC1 |
| InChI | InChI=1S/C19H29N3O3/c1-13(2)9-18(23)21-16-7-6-14(3)17(10-16)22-19(24)20-11-15-5-4-8-25-12-15/h6-7,10,13,15H,4-5,8-9,11-12H2,1-3H3,(H,21,23)(H2,20,22,24)/t15-/m0/s1 |
| InChIKey | OVFBANJRURUINX-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |