C19H31N3O4 — CID 126452003
1-[(1S)-1-(2,4-dimethoxyphenyl)ethyl]-1-methyl-3-(3-morpholin-4-ylpropyl)urea (PubChem CID 126452003) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-dimethoxyphenyl)ethyl]-1-methyl-3-(3-morpholin-4-ylpropyl)urea.
| Compound Name | 1-[(1S)-1-(2,4-dimethoxyphenyl)ethyl]-1-methyl-3-(3-morpholin-4-ylpropyl)urea |
|---|---|
| PubChem CID | 126452003 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 1-[(1S)-1-(2,4-dimethoxyphenyl)ethyl]-1-methyl-3-(3-morpholin-4-ylpropyl)urea |
| SMILES | COc1ccc([C@H](C)N(C)C(=O)NCCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H31N3O4/c1-15(17-7-6-16(24-3)14-18(17)25-4)21(2)19(23)20-8-5-9-22-10-12-26-13-11-22/h6-7,14-15H,5,8-13H2,1-4H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | WBWPFGFNOWKJRW-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|