C19H31N3O6S — CID 30150418
2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 30150418) has the molecular formula C19H31N3O6S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 30150418 |
| Molecular Formula | C19H31N3O6S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[ethylsulfonyl(methyl)amino]-4,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CCS(=O)(=O)N(C)c1cc(OC)c(OC)cc1C(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C19H31N3O6S/c1-5-29(24,25)21(2)16-14-18(27-4)17(26-3)13-15(16)19(23)20-7-6-8-22-9-11-28-12-10-22/h13-14H,5-12H2,1-4H3,(H,20,23) |
| InChIKey | DLZRILKSOIWVME-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|