C19H21N3O4S2 — CID 126458768
7-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-4H-1,4-benzothiazin-3-one (PubChem CID 126458768) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 7-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 7-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126458768 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 7-[4-(3-methoxyphenyl)piperazin-1-yl]sulfonyl-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cccc(N2CCN(S(=O)(=O)c3ccc4c(c3)SCC(=O)N4)CC2)c1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-26-15-4-2-3-14(11-15)21-7-9-22(10-8-21)28(24,25)16-5-6-17-18(12-16)27-13-19(23)20-17/h2-6,11-12H,7-10,13H2,1H3,(H,20,23) |
| InChIKey | MTSQPNMYWHPYJD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |