C21H25N3O4S2 — CID 20935255
7-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 20935255) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 7-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
| Compound Name | 7-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 20935255 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 7-[4-(4-methoxyphenyl)piperazin-1-yl]sulfonyl-2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | COc1ccc(N2CCN(S(=O)(=O)c3ccc4c(c3)NC(=O)CC(C)S4)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-15-13-21(25)22-19-14-18(7-8-20(19)29-15)30(26,27)24-11-9-23(10-12-24)16-3-5-17(28-2)6-4-16/h3-8,14-15H,9-13H2,1-2H3,(H,22,25) |
| InChIKey | DFOKUYFHKYSRDG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|