C17H21N3O5 — CID 126462089
(4-methylphenyl) (7S,9aR)-7-(hydroxymethyl)-8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate (PubChem CID 126462089) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is (4-methylphenyl) (7S,9aR)-7-(hydroxymethyl)-8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate.
| Compound Name | (4-methylphenyl) (7S,9aR)-7-(hydroxymethyl)-8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 126462089 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (4-methylphenyl) (7S,9aR)-7-(hydroxymethyl)-8-methyl-6,9-dioxo-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCN3C(=O)[C@H](CO)N(C)C(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C17H21N3O5/c1-11-3-5-12(6-4-11)25-17(24)19-7-8-20-13(9-19)15(22)18(2)14(10-21)16(20)23/h3-6,13-14,21H,7-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | XNMZSVWXFTUYBD-KGLIPLIRSA-N |
| XLogP | -0.16 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |