C18H21N3O5 — CID 126460392
(4-methylphenyl) (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate (PubChem CID 126460392) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (4-methylphenyl) (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate.
| Compound Name | (4-methylphenyl) (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate |
|---|---|
| PubChem CID | 126460392 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (4-methylphenyl) (3S,5R,9R)-5-hydroxy-2,8-dioxo-1,7,11-triazatricyclo[7.4.0.03,7]tridecane-11-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCN3C(=O)[C@@H]4C[C@@H](O)CN4C(=O)[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-11-2-4-13(5-3-11)26-18(25)19-6-7-20-15(10-19)17(24)21-9-12(22)8-14(21)16(20)23/h2-5,12,14-15,22H,6-10H2,1H3/t12-,14+,15-/m1/s1 |
| InChIKey | XBAZJMXBKLLSLP-VHDGCEQUSA-N |
| XLogP | -0.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |