C25H34N4O2 — CID 126462817
4-[[1-(6-methoxy-4-methylquinazolin-2-yl)piperidin-4-yl]amino]adamantan-1-ol (PubChem CID 126462817) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[[1-(6-methoxy-4-methylquinazolin-2-yl)piperidin-4-yl]amino]adamantan-1-ol.
| Compound Name | 4-[[1-(6-methoxy-4-methylquinazolin-2-yl)piperidin-4-yl]amino]adamantan-1-ol |
|---|---|
| PubChem CID | 126462817 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-[[1-(6-methoxy-4-methylquinazolin-2-yl)piperidin-4-yl]amino]adamantan-1-ol |
| SMILES | COc1ccc2nc(N3CCC(NC4C5CC6CC4CC(O)(C6)C5)CC3)nc(C)c2c1 |
| InChI | InChI=1S/C25H34N4O2/c1-15-21-11-20(31-2)3-4-22(21)28-24(26-15)29-7-5-19(6-8-29)27-23-17-9-16-10-18(23)14-25(30,12-16)13-17/h3-4,11,16-19,23,27,30H,5-10,12-14H2,1-2H3 |
| InChIKey | VRLQCDVIAHQVNE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |