C20H33N3O2 — CID 126478016
N-[3-(dipropylamino)propyl]-N'-(4-propan-2-ylphenyl)oxamide (PubChem CID 126478016) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[3-(dipropylamino)propyl]-N'-(4-propan-2-ylphenyl)oxamide.
| Compound Name | N-[3-(dipropylamino)propyl]-N'-(4-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 126478016 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[3-(dipropylamino)propyl]-N'-(4-propan-2-ylphenyl)oxamide |
| SMILES | CCCN(CCC)CCCNC(=O)C(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O2/c1-5-13-23(14-6-2)15-7-12-21-19(24)20(25)22-18-10-8-17(9-11-18)16(3)4/h8-11,16H,5-7,12-15H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | HNQMUPIZOUQVMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|