C25H36N4O3 — CID 44522366
4-[3-(dipropylamino)propylamino]-3-nitro-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 44522366) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is 4-[3-(dipropylamino)propylamino]-3-nitro-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 4-[3-(dipropylamino)propylamino]-3-nitro-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 44522366 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 4-[3-(dipropylamino)propylamino]-3-nitro-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | CCCN(CCC)CCCNc1ccc(C(=O)Nc2ccc(C(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H36N4O3/c1-5-15-28(16-6-2)17-7-14-26-23-13-10-21(18-24(23)29(31)32)25(30)27-22-11-8-20(9-12-22)19(3)4/h8-13,18-19,26H,5-7,14-17H2,1-4H3,(H,27,30) |
| InChIKey | UZZFMTVYVYCSCB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|